C11H18N4O2 — CID 114183623
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperidin-3-ylacetamide (PubChem CID 114183623) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperidin-3-ylacetamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 114183623 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperidin-3-ylacetamide |
| SMILES | O=C(CC1CCCNC1)NCCc1ncno1 |
| InChI | InChI=1S/C11H18N4O2/c16-10(6-9-2-1-4-12-7-9)13-5-3-11-14-8-15-17-11/h8-9,12H,1-7H2,(H,13,16) |
| InChIKey | AZIQGSVYPLPCCT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |