C11H19N3O3 — CID 106398179
N-(2-but-3-enoxyethyl)-5-oxopiperazine-2-carboxamide (PubChem CID 106398179) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(2-but-3-enoxyethyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 106398179 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-5-oxopiperazine-2-carboxamide |
| SMILES | C=CCCOCCNC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C11H19N3O3/c1-2-3-5-17-6-4-12-11(16)9-7-14-10(15)8-13-9/h2,9,13H,1,3-8H2,(H,12,16)(H,14,15) |
| InChIKey | AQLLJBATUBSGCS-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|