About ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate
ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate (PubChem CID 106398643) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate.
Analyze ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate?
The IUPAC name of ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate (CID 106398643) is ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate.
What is the SMILES notation for ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate?
The canonical SMILES for ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate is CCOC(=O)C(C)CNCc1ncon1.
What is the InChIKey of ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate?
The InChIKey is ASPMIMOGUVLZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-3-14-9(13)7(2)4-10-5-8-11-6-15-12-8/h6-7,10H,3-5H2,1-2H3.
What are the key properties of ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate?
ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate has a molecular weight of 213.24 g/mol, XLogP of 0.36, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate is sourced from PubChem (CID 106398643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).