C9H15N3O4 — CID 106399515
methyl 2-hydroxy-2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate (PubChem CID 106399515) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 106399515 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoate |
| SMILES | COC(=O)C(C)(O)CNCCc1ncno1 |
| InChI | InChI=1S/C9H15N3O4/c1-9(14,8(13)15-2)5-10-4-3-7-11-6-12-16-7/h6,10,14H,3-5H2,1-2H3 |
| InChIKey | LQIXTQISLBQIDZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|