C10H16N4O2S — CID 106399310
2-carbamothioyl-2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide (PubChem CID 106399310) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-carbamothioyl-2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide.
| Compound Name | 2-carbamothioyl-2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 106399310 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-carbamothioyl-2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide |
| SMILES | CCC(C)(C(=O)NCCc1ncno1)C(N)=S |
| InChI | InChI=1S/C10H16N4O2S/c1-3-10(2,8(11)17)9(15)12-5-4-7-13-6-14-16-7/h6H,3-5H2,1-2H3,(H2,11,17)(H,12,15) |
| InChIKey | FENAYCJKHNNUBE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|