C12H18N2OS2 — CID 113270556
2-carbamothioyl-2-methyl-N-(2-thiophen-3-ylethyl)butanamide (PubChem CID 113270556) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-carbamothioyl-2-methyl-N-(2-thiophen-3-ylethyl)butanamide.
| Compound Name | 2-carbamothioyl-2-methyl-N-(2-thiophen-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 113270556 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-carbamothioyl-2-methyl-N-(2-thiophen-3-ylethyl)butanamide |
| SMILES | CCC(C)(C(=O)NCCc1ccsc1)C(N)=S |
| InChI | InChI=1S/C12H18N2OS2/c1-3-12(2,10(13)16)11(15)14-6-4-9-5-7-17-8-9/h5,7-8H,3-4,6H2,1-2H3,(H2,13,16)(H,14,15) |
| InChIKey | XFTYTGIIJPRYPS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|