C10H15N3O2S2 — CID 106381468
2-carbamothioyl-2-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 106381468) has the molecular formula C10H15N3O2S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-carbamothioyl-2-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | 2-carbamothioyl-2-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 106381468 |
| Molecular Formula | C10H15N3O2S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-carbamothioyl-2-methyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | CCC(C)(C(=O)NCc1csc(=O)[nH]1)C(N)=S |
| InChI | InChI=1S/C10H15N3O2S2/c1-3-10(2,7(11)16)8(14)12-4-6-5-17-9(15)13-6/h5H,3-4H2,1-2H3,(H2,11,16)(H,12,14)(H,13,15) |
| InChIKey | WWVVMQDODQNWFI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|