C9H12N2OS2 — CID 66354566
3-amino-2,2-dimethyl-3-sulfanylidene-N-thiophen-3-ylpropanamide (PubChem CID 66354566) has the molecular formula C9H12N2OS2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-3-sulfanylidene-N-thiophen-3-ylpropanamide.
| Compound Name | 3-amino-2,2-dimethyl-3-sulfanylidene-N-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 66354566 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3-amino-2,2-dimethyl-3-sulfanylidene-N-thiophen-3-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccsc1)C(N)=S |
| InChI | InChI=1S/C9H12N2OS2/c1-9(2,7(10)13)8(12)11-6-3-4-14-5-6/h3-5H,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | ZGLQRIQZGOYJIG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|