C12H17ClN2OS2 — CID 106035479
2-carbamothioyl-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylbutanamide (PubChem CID 106035479) has the molecular formula C12H17ClN2OS2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 2-carbamothioyl-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 106035479 |
| Molecular Formula | C12H17ClN2OS2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-carbamothioyl-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NCCc1ccc(Cl)s1)C(N)=S |
| InChI | InChI=1S/C12H17ClN2OS2/c1-3-12(2,10(14)17)11(16)15-7-6-8-4-5-9(13)18-8/h4-5H,3,6-7H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | RYCCLXHFCSXGHS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|