C13H25N3O4 — CID 106399575
1-(2-butoxyethoxy)-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propan-2-ol (PubChem CID 106399575) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propan-2-ol.
| Compound Name | 1-(2-butoxyethoxy)-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106399575 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 1-(2-butoxyethoxy)-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propan-2-ol |
| SMILES | CCCCOCCOCC(O)CNCCc1ncno1 |
| InChI | InChI=1S/C13H25N3O4/c1-2-3-6-18-7-8-19-10-12(17)9-14-5-4-13-15-11-16-20-13/h11-12,14,17H,2-10H2,1H3 |
| InChIKey | AGPFSWKSEAYGMR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|