C7H13N3O3 — CID 106399669
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propane-1,2-diol (PubChem CID 106399669) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 106399669 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCCc1ncno1 |
| InChI | InChI=1S/C7H13N3O3/c11-4-6(12)3-8-2-1-7-9-5-10-13-7/h5-6,8,11-12H,1-4H2 |
| InChIKey | ZLALLAOVUDPLFB-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|