C7H11N3O3 — CID 106399859
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid (PubChem CID 106399859) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid.
| Compound Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 106399859 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]propanoic acid |
| SMILES | O=C(O)CCNCCc1ncno1 |
| InChI | InChI=1S/C7H11N3O3/c11-7(12)2-4-8-3-1-6-9-5-10-13-6/h5,8H,1-4H2,(H,11,12) |
| InChIKey | HVEGRMNZNSQRQS-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|