C10H15N3O3 — CID 106402021
2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid (PubChem CID 106402021) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106402021 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid |
| SMILES | CCC(=CCNCCc1ncon1)C(=O)O |
| InChI | InChI=1S/C10H15N3O3/c1-2-8(10(14)15)3-5-11-6-4-9-12-7-16-13-9/h3,7,11H,2,4-6H2,1H3,(H,14,15) |
| InChIKey | RHVXMWKLWWHHHW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|