2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid

C10H15N3O3 — CID 106402021

IUPAC2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid
SMILESCCC(=CCNCCc1ncon1)C(=O)O
InChIInChI=1S/C10H15N3O3/c1-2-8(10(14)15)3-5-11-6-4-9-12-7-16-13-9/h3,7,11H,2,4-6H2,1H3,(H,14,15)
InChIKeyRHVXMWKLWWHHHW-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.62
Rot. Bonds7

About 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid

2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid (PubChem CID 106402021) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid.

Molecular Properties

Compound Name2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid
PubChem CID106402021
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid
SMILESCCC(=CCNCCc1ncon1)C(=O)O
InChIInChI=1S/C10H15N3O3/c1-2-8(10(14)15)3-5-11-6-4-9-12-7-16-13-9/h3,7,11H,2,4-6H2,1H3,(H,14,15)
InChIKeyRHVXMWKLWWHHHW-UHFFFAOYSA-N
XLogP0.62
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The IUPAC name of 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid (CID 106402021) is 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid is CCC(=CCNCCc1ncon1)C(=O)O.
What is the InChIKey of 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The InChIKey is RHVXMWKLWWHHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-2-8(10(14)15)3-5-11-6-4-9-12-7-16-13-9/h3,7,11H,2,4-6H2,1H3,(H,14,15).
What are the key properties of 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid has a molecular weight of 225.25 g/mol, XLogP of 0.62, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[2-(1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid is sourced from PubChem (CID 106402021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).