methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate

C10H15N3O3 — CID 106401856

IUPACmethyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate
SMILESCCC(=CCNCc1ncon1)C(=O)OC
InChIInChI=1S/C10H15N3O3/c1-3-8(10(14)15-2)4-5-11-6-9-12-7-16-13-9/h4,7,11H,3,5-6H2,1-2H3
InChIKeyLZFVKVYJMMBUIV-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.67
Rot. Bonds6

About methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate

methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate (PubChem CID 106401856) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate.

Molecular Properties

Compound Namemethyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate
PubChem CID106401856
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Namemethyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate
SMILESCCC(=CCNCc1ncon1)C(=O)OC
InChIInChI=1S/C10H15N3O3/c1-3-8(10(14)15-2)4-5-11-6-9-12-7-16-13-9/h4,7,11H,3,5-6H2,1-2H3
InChIKeyLZFVKVYJMMBUIV-UHFFFAOYSA-N
XLogP0.67
TPSA77.25 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate (CID 106401856) is methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate is CCC(=CCNCc1ncon1)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate?
The InChIKey is LZFVKVYJMMBUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-3-8(10(14)15-2)4-5-11-6-9-12-7-16-13-9/h4,7,11H,3,5-6H2,1-2H3.
What are the key properties of methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate?
methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate has a molecular weight of 225.25 g/mol, XLogP of 0.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(1,2,4-oxadiazol-3-ylmethylamino)but-2-enoate is sourced from PubChem (CID 106401856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).