C6H6N4OS — CID 106403375
N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 106403375) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106403375 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | c1csc(NCc2ncon2)n1 |
| InChI | InChI=1S/C6H6N4OS/c1-2-12-6(7-1)8-3-5-9-4-11-10-5/h1-2,4H,3H2,(H,7,8) |
| InChIKey | AMWOZNAHGCOKQU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |