C12H13ClN6O2 — CID 106407091
5-[2-[8-(1-chloroethyl)-6-methoxypurin-9-yl]ethyl]-1,2,4-oxadiazole (PubChem CID 106407091) has the molecular formula C12H13ClN6O2 and a molecular weight of 308.73 g/mol. Its IUPAC name is 5-[2-[8-(1-chloroethyl)-6-methoxypurin-9-yl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-[2-[8-(1-chloroethyl)-6-methoxypurin-9-yl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106407091 |
| Molecular Formula | C12H13ClN6O2 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-[2-[8-(1-chloroethyl)-6-methoxypurin-9-yl]ethyl]-1,2,4-oxadiazole |
| SMILES | COc1ncnc2c1nc(C(C)Cl)n2CCc1ncno1 |
| InChI | InChI=1S/C12H13ClN6O2/c1-7(13)10-18-9-11(15-5-16-12(9)20-2)19(10)4-3-8-14-6-17-21-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | BNHKMXFORBQDIH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|