C12H12BrN5OS — CID 106036150
9-[2-(5-bromothiophen-2-yl)ethyl]-6-methoxypurin-8-amine (PubChem CID 106036150) has the molecular formula C12H12BrN5OS and a molecular weight of 354.23 g/mol. Its IUPAC name is 9-[2-(5-bromothiophen-2-yl)ethyl]-6-methoxypurin-8-amine.
| Compound Name | 9-[2-(5-bromothiophen-2-yl)ethyl]-6-methoxypurin-8-amine |
|---|---|
| PubChem CID | 106036150 |
| Molecular Formula | C12H12BrN5OS |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 9-[2-(5-bromothiophen-2-yl)ethyl]-6-methoxypurin-8-amine |
| SMILES | COc1ncnc2c1nc(N)n2CCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H12BrN5OS/c1-19-11-9-10(15-6-16-11)18(12(14)17-9)5-4-7-2-3-8(13)20-7/h2-3,6H,4-5H2,1H3,(H2,14,17) |
| InChIKey | FZDZXAXKDFHJGG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |