C12H9Br2N5O — CID 107601316
9-(2,6-dibromophenyl)-6-methoxypurin-8-amine (PubChem CID 107601316) has the molecular formula C12H9Br2N5O and a molecular weight of 399.05 g/mol. Its IUPAC name is 9-(2,6-dibromophenyl)-6-methoxypurin-8-amine.
| Compound Name | 9-(2,6-dibromophenyl)-6-methoxypurin-8-amine |
|---|---|
| PubChem CID | 107601316 |
| Molecular Formula | C12H9Br2N5O |
| Molecular Weight | 399.05 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | 9-(2,6-dibromophenyl)-6-methoxypurin-8-amine |
| SMILES | COc1ncnc2c1nc(N)n2-c1c(Br)cccc1Br |
| InChI | InChI=1S/C12H9Br2N5O/c1-20-11-8-10(16-5-17-11)19(12(15)18-8)9-6(13)3-2-4-7(9)14/h2-5H,1H3,(H2,15,18) |
| InChIKey | INSTZYSCUMBNJM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |