C11H17N7O — CID 106412550
6-hydrazinyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-5-propan-2-ylpyrimidin-4-amine (PubChem CID 106412550) has the molecular formula C11H17N7O and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106412550 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 6-hydrazinyl-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1c(NN)ncnc1NCCc1ncon1 |
| InChI | InChI=1S/C11H17N7O/c1-7(2)9-10(14-5-15-11(9)17-12)13-4-3-8-16-6-19-18-8/h5-7H,3-4,12H2,1-2H3,(H2,13,14,15,17) |
| InChIKey | APDAFENRQLNOJN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|