C15H31NO2SSi2 — CID 10641276
(1,1-dioxo-3-piperidin-1-yl-2-trimethylsilyl-2,3-dihydrothiophen-5-yl)-trimethylsilane (PubChem CID 10641276) has the molecular formula C15H31NO2SSi2 and a molecular weight of 345.66 g/mol. Its IUPAC name is (1,1-dioxo-3-piperidin-1-yl-2-trimethylsilyl-2,3-dihydrothiophen-5-yl)-trimethylsilane.
| Compound Name | (1,1-dioxo-3-piperidin-1-yl-2-trimethylsilyl-2,3-dihydrothiophen-5-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10641276 |
| Molecular Formula | C15H31NO2SSi2 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (1,1-dioxo-3-piperidin-1-yl-2-trimethylsilyl-2,3-dihydrothiophen-5-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC(N2CCCCC2)C([Si](C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C15H31NO2SSi2/c1-20(2,3)14-12-13(16-10-8-7-9-11-16)15(19(14,17)18)21(4,5)6/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | YVMLWLRNQLPRPQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|