C15H31GeNO2SSi — CID 10762955
(1,1-dioxo-3-piperidin-1-yl-5-trimethylgermyl-2,3-dihydrothiophen-2-yl)-trimethylsilane (PubChem CID 10762955) has the molecular formula C15H31GeNO2SSi and a molecular weight of 390.18 g/mol. Its IUPAC name is (1,1-dioxo-3-piperidin-1-yl-5-trimethylgermyl-2,3-dihydrothiophen-2-yl)-trimethylsilane.
| Compound Name | (1,1-dioxo-3-piperidin-1-yl-5-trimethylgermyl-2,3-dihydrothiophen-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10762955 |
| Molecular Formula | C15H31GeNO2SSi |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (1,1-dioxo-3-piperidin-1-yl-5-trimethylgermyl-2,3-dihydrothiophen-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1C(N2CCCCC2)C=C([Ge](C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C15H31GeNO2SSi/c1-16(2,3)14-12-13(17-10-8-7-9-11-17)15(20(14,18)19)21(4,5)6/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | LYBABHTXYXUVLP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|