C12H23NO2SSi — CID 10826142
(1,1-dioxo-3-piperidin-1-yl-2,3-dihydrothiophen-5-yl)-trimethylsilane (PubChem CID 10826142) has the molecular formula C12H23NO2SSi and a molecular weight of 273.47 g/mol. Its IUPAC name is (1,1-dioxo-3-piperidin-1-yl-2,3-dihydrothiophen-5-yl)-trimethylsilane.
| Compound Name | (1,1-dioxo-3-piperidin-1-yl-2,3-dihydrothiophen-5-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10826142 |
| Molecular Formula | C12H23NO2SSi |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1,1-dioxo-3-piperidin-1-yl-2,3-dihydrothiophen-5-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC(N2CCCCC2)CS1(=O)=O |
| InChI | InChI=1S/C12H23NO2SSi/c1-17(2,3)12-9-11(10-16(12,14)15)13-7-5-4-6-8-13/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | CSRLUICWADBIOY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|