C11H17N3O2 — CID 106415590
1-cyclohexyl-3-(1,2-oxazol-5-ylmethyl)urea (PubChem CID 106415590) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,2-oxazol-5-ylmethyl)urea.
| Compound Name | 1-cyclohexyl-3-(1,2-oxazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 106415590 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 1-cyclohexyl-3-(1,2-oxazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ccno1)NC1CCCCC1 |
| InChI | InChI=1S/C11H17N3O2/c15-11(12-8-10-6-7-13-16-10)14-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H2,12,14,15) |
| InChIKey | YUBPOYWOTYKHJG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |