2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid

C12H17N3O4 — CID 106421064

IUPAC2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)NCc1ccno1)C1CCCC1
InChIInChI=1S/C12H17N3O4/c16-11(17)8-15(9-3-1-2-4-9)12(18)13-7-10-5-6-14-19-10/h5-6,9H,1-4,7-8H2,(H,13,18)(H,16,17)
InChIKeyBVJLUGAKZZEHDD-UHFFFAOYSA-N
MW267.28 g/mol
LogP1.21
Rot. Bonds5

About 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid

2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid (PubChem CID 106421064) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid
PubChem CID106421064
Molecular FormulaC12H17N3O4
Molecular Weight267.28 g/mol
Exact Mass267.12
IUPAC Name2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)NCc1ccno1)C1CCCC1
InChIInChI=1S/C12H17N3O4/c16-11(17)8-15(9-3-1-2-4-9)12(18)13-7-10-5-6-14-19-10/h5-6,9H,1-4,7-8H2,(H,13,18)(H,16,17)
InChIKeyBVJLUGAKZZEHDD-UHFFFAOYSA-N
XLogP1.21
TPSA95.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid?
The IUPAC name of 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid (CID 106421064) is 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid is O=C(O)CN(C(=O)NCc1ccno1)C1CCCC1.
What is the InChIKey of 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid?
The InChIKey is BVJLUGAKZZEHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c16-11(17)8-15(9-3-1-2-4-9)12(18)13-7-10-5-6-14-19-10/h5-6,9H,1-4,7-8H2,(H,13,18)(H,16,17).
What are the key properties of 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid?
2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid has a molecular weight of 267.28 g/mol, XLogP of 1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl(1,2-oxazol-5-ylmethylcarbamoyl)amino]acetic acid is sourced from PubChem (CID 106421064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).