C10H17N3O — CID 106415743
4-N-(1,2-oxazol-5-ylmethyl)cyclohexane-1,4-diamine (PubChem CID 106415743) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-N-(1,2-oxazol-5-ylmethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(1,2-oxazol-5-ylmethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 106415743 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-N-(1,2-oxazol-5-ylmethyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2ccno2)CC1 |
| InChI | InChI=1S/C10H17N3O/c11-8-1-3-9(4-2-8)12-7-10-5-6-13-14-10/h5-6,8-9,12H,1-4,7,11H2 |
| InChIKey | NVMBIWIWNWAJJT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |