C9H15N3O — CID 106415423
3-N-(1,2-oxazol-5-ylmethyl)cyclopentane-1,3-diamine (PubChem CID 106415423) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-N-(1,2-oxazol-5-ylmethyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(1,2-oxazol-5-ylmethyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 106415423 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-N-(1,2-oxazol-5-ylmethyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(NCc2ccno2)C1 |
| InChI | InChI=1S/C9H15N3O/c10-7-1-2-8(5-7)11-6-9-3-4-12-13-9/h3-4,7-8,11H,1-2,5-6,10H2 |
| InChIKey | XUOIVEANOZBEPY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |