C11H17IN2O — CID 62318504
4-N-[(5-iodofuran-2-yl)methyl]cyclohexane-1,4-diamine (PubChem CID 62318504) has the molecular formula C11H17IN2O and a molecular weight of 320.17 g/mol. Its IUPAC name is 4-N-[(5-iodofuran-2-yl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(5-iodofuran-2-yl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62318504 |
| Molecular Formula | C11H17IN2O |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-N-[(5-iodofuran-2-yl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2ccc(I)o2)CC1 |
| InChI | InChI=1S/C11H17IN2O/c12-11-6-5-10(15-11)7-14-9-3-1-8(13)2-4-9/h5-6,8-9,14H,1-4,7,13H2 |
| InChIKey | NTDCJOWSXWZSIU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|