C13H21IN2O3S — CID 43791483
N-[(5-iodofuran-2-yl)methyl]-1-propylsulfonylpiperidin-4-amine (PubChem CID 43791483) has the molecular formula C13H21IN2O3S and a molecular weight of 412.29 g/mol. Its IUPAC name is N-[(5-iodofuran-2-yl)methyl]-1-propylsulfonylpiperidin-4-amine.
| Compound Name | N-[(5-iodofuran-2-yl)methyl]-1-propylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 43791483 |
| Molecular Formula | C13H21IN2O3S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | N-[(5-iodofuran-2-yl)methyl]-1-propylsulfonylpiperidin-4-amine |
| SMILES | CCCS(=O)(=O)N1CCC(NCc2ccc(I)o2)CC1 |
| InChI | InChI=1S/C13H21IN2O3S/c1-2-9-20(17,18)16-7-5-11(6-8-16)15-10-12-3-4-13(14)19-12/h3-4,11,15H,2,5-10H2,1H3 |
| InChIKey | ZPKUQSLACRFWHU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|