C13H19IN2O3 — CID 43791424
1-[4-[(5-iodofuran-2-yl)methylamino]piperidin-1-yl]-2-methoxyethanone (PubChem CID 43791424) has the molecular formula C13H19IN2O3 and a molecular weight of 378.21 g/mol. Its IUPAC name is 1-[4-[(5-iodofuran-2-yl)methylamino]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[(5-iodofuran-2-yl)methylamino]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 43791424 |
| Molecular Formula | C13H19IN2O3 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-[4-[(5-iodofuran-2-yl)methylamino]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(NCc2ccc(I)o2)CC1 |
| InChI | InChI=1S/C13H19IN2O3/c1-18-9-13(17)16-6-4-10(5-7-16)15-8-11-2-3-12(14)19-11/h2-3,10,15H,4-9H2,1H3 |
| InChIKey | NUJWPQBHHVOILD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|