C21H22N2O3 — CID 10641598
(6E)-1-benzyl-3-hydroxy-6-(2-methylpropylidene)-3-phenylpiperazine-2,5-dione (PubChem CID 10641598) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (6E)-1-benzyl-3-hydroxy-6-(2-methylpropylidene)-3-phenylpiperazine-2,5-dione.
| Compound Name | (6E)-1-benzyl-3-hydroxy-6-(2-methylpropylidene)-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 10641598 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (6E)-1-benzyl-3-hydroxy-6-(2-methylpropylidene)-3-phenylpiperazine-2,5-dione |
| SMILES | CC(C)/C=C1\C(=O)NC(O)(c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c1-15(2)13-18-19(24)22-21(26,17-11-7-4-8-12-17)20(25)23(18)14-16-9-5-3-6-10-16/h3-13,15,26H,14H2,1-2H3,(H,22,24)/b18-13+ |
| InChIKey | DSZXXFKXKWYWHS-QGOAFFKASA-N |
| XLogP | 2.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|