C17H20N2O3 — CID 15914220
(3E)-1-acetyl-4-benzyl-3-(2-methylpropylidene)piperazine-2,5-dione (PubChem CID 15914220) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3E)-1-acetyl-4-benzyl-3-(2-methylpropylidene)piperazine-2,5-dione.
| Compound Name | (3E)-1-acetyl-4-benzyl-3-(2-methylpropylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 15914220 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3E)-1-acetyl-4-benzyl-3-(2-methylpropylidene)piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)N(Cc2ccccc2)/C(=C/C(C)C)C1=O |
| InChI | InChI=1S/C17H20N2O3/c1-12(2)9-15-17(22)18(13(3)20)11-16(21)19(15)10-14-7-5-4-6-8-14/h4-9,12H,10-11H2,1-3H3/b15-9+ |
| InChIKey | HLCXXAUGEFPOBV-OQLLNIDSSA-N |
| XLogP | 1.94 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|