C15H16N2O4 — CID 54486617
propan-2-yl 2-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)acetate (PubChem CID 54486617) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is propan-2-yl 2-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)acetate.
| Compound Name | propan-2-yl 2-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)acetate |
|---|---|
| PubChem CID | 54486617 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | propan-2-yl 2-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)acetate |
| SMILES | CC(C)OC(=O)C=C1NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O4/c1-10(2)21-13(18)8-12-14(19)17(15(20)16-12)9-11-6-4-3-5-7-11/h3-8,10H,9H2,1-2H3,(H,16,20) |
| InChIKey | XSTNLCFVNBHCGU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|