C16H21N3O6 — CID 10641656
methyl (2S)-2-azido-2-[(4S,5S)-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 10641656) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is methyl (2S)-2-azido-2-[(4S,5S)-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl (2S)-2-azido-2-[(4S,5S)-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 10641656 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl (2S)-2-azido-2-[(4S,5S)-5-[(4-methoxyphenoxy)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@@H]1OC(C)(C)O[C@H]1COc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21N3O6/c1-16(2)24-12(9-23-11-7-5-10(21-3)6-8-11)14(25-16)13(18-19-17)15(20)22-4/h5-8,12-14H,9H2,1-4H3/t12-,13-,14+/m0/s1 |
| InChIKey | OCJWDAUUAUIIMY-MELADBBJSA-N |
| XLogP | 2.45 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|