C18H27N2O10P — CID 46915055
methyl (2S)-2-[[[(4R,5R)-5-(hydroxycarbamoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 46915055) has the molecular formula C18H27N2O10P and a molecular weight of 462.39 g/mol. Its IUPAC name is methyl (2S)-2-[[[(4R,5R)-5-(hydroxycarbamoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(4R,5R)-5-(hydroxycarbamoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 46915055 |
| Molecular Formula | C18H27N2O10P |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | methyl (2S)-2-[[[(4R,5R)-5-(hydroxycarbamoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1OC(C)(C)O[C@H]1C(=O)NO)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H27N2O10P/c1-11(17(22)26-5)20-31(24,30-13-8-6-12(25-4)7-9-13)27-10-14-15(16(21)19-23)29-18(2,3)28-14/h6-9,11,14-15,23H,10H2,1-5H3,(H,19,21)(H,20,24)/t11-,14+,15+,31?/m0/s1 |
| InChIKey | HOPIGABLXFAXMU-ZHIGUIJXSA-N |
| XLogP | 1.38 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|