C14H17N3O8 — CID 10641900
4-methoxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 10641900) has the molecular formula C14H17N3O8 and a molecular weight of 355.30 g/mol. Its IUPAC name is 4-methoxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 4-methoxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 10641900 |
| Molecular Formula | C14H17N3O8 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-methoxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | COc1nc(N[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc2c1C(=O)NC2=O |
| InChI | InChI=1S/C14H17N3O8/c1-24-13-7-4(11(22)17-12(7)23)2-6(15-13)16-14-10(21)9(20)8(19)5(3-18)25-14/h2,5,8-10,14,18-21H,3H2,1H3,(H,15,16)(H,17,22,23)/t5-,8-,9+,10-,14-/m1/s1 |
| InChIKey | TWBQOOBKWICMAO-YJVUEFFUSA-N |
| XLogP | -2.81 |
| TPSA | 170.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|