C19H19N3O9 — CID 169329118
4-amino-5-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169329118) has the molecular formula C19H19N3O9 and a molecular weight of 433.37 g/mol. Its IUPAC name is 4-amino-5-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169329118 |
| Molecular Formula | C19H19N3O9 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-amino-5-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(OC3OC(CO)C(O)C(O)C3O)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C19H19N3O9/c20-16-12-9(17(28)21-18(12)29)5-11(24)22(16)7-1-3-8(4-2-7)30-19-15(27)14(26)13(25)10(6-23)31-19/h1-5,10,13-15,19,23,25-27H,6,20H2,(H,21,28,29) |
| InChIKey | PAEMZMXYHAQPEO-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 193.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|