C11H8ClN3O5 — CID 106419286
3-chloro-5-nitro-2-(1,2-oxazol-5-ylmethylamino)benzoic acid (PubChem CID 106419286) has the molecular formula C11H8ClN3O5 and a molecular weight of 297.65 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-(1,2-oxazol-5-ylmethylamino)benzoic acid.
| Compound Name | 3-chloro-5-nitro-2-(1,2-oxazol-5-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 106419286 |
| Molecular Formula | C11H8ClN3O5 |
| Molecular Weight | 297.65 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 3-chloro-5-nitro-2-(1,2-oxazol-5-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(Cl)c1NCc1ccno1 |
| InChI | InChI=1S/C11H8ClN3O5/c12-9-4-6(15(18)19)3-8(11(16)17)10(9)13-5-7-1-2-14-20-7/h1-4,13H,5H2,(H,16,17) |
| InChIKey | OYULGBKMFJFVEM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|