C11H8ClN3O4S — CID 107191316
3-chloro-5-nitro-2-(1,3-thiazol-5-ylmethylamino)benzoic acid (PubChem CID 107191316) has the molecular formula C11H8ClN3O4S and a molecular weight of 313.72 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-(1,3-thiazol-5-ylmethylamino)benzoic acid.
| Compound Name | 3-chloro-5-nitro-2-(1,3-thiazol-5-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 107191316 |
| Molecular Formula | C11H8ClN3O4S |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-chloro-5-nitro-2-(1,3-thiazol-5-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(Cl)c1NCc1cncs1 |
| InChI | InChI=1S/C11H8ClN3O4S/c12-9-2-6(15(18)19)1-8(11(16)17)10(9)14-4-7-3-13-5-20-7/h1-3,5,14H,4H2,(H,16,17) |
| InChIKey | ONWFQBIYDXIBHP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|