C11H10ClF3N2O4 — CID 107191041
3-chloro-5-nitro-2-(4,4,4-trifluorobutylamino)benzoic acid (PubChem CID 107191041) has the molecular formula C11H10ClF3N2O4 and a molecular weight of 326.66 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-(4,4,4-trifluorobutylamino)benzoic acid.
| Compound Name | 3-chloro-5-nitro-2-(4,4,4-trifluorobutylamino)benzoic acid |
|---|---|
| PubChem CID | 107191041 |
| Molecular Formula | C11H10ClF3N2O4 |
| Molecular Weight | 326.66 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-chloro-5-nitro-2-(4,4,4-trifluorobutylamino)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(Cl)c1NCCCC(F)(F)F |
| InChI | InChI=1S/C11H10ClF3N2O4/c12-8-5-6(17(20)21)4-7(10(18)19)9(8)16-3-1-2-11(13,14)15/h4-5,16H,1-3H2,(H,18,19) |
| InChIKey | YCTXPPAWJGUPDM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|