C12H12N4O — CID 106419832
4-methyl-1-(1,2-oxazol-5-ylmethyl)benzimidazol-2-amine (PubChem CID 106419832) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-methyl-1-(1,2-oxazol-5-ylmethyl)benzimidazol-2-amine.
| Compound Name | 4-methyl-1-(1,2-oxazol-5-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 106419832 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-methyl-1-(1,2-oxazol-5-ylmethyl)benzimidazol-2-amine |
| SMILES | Cc1cccc2c1nc(N)n2Cc1ccno1 |
| InChI | InChI=1S/C12H12N4O/c1-8-3-2-4-10-11(8)15-12(13)16(10)7-9-5-6-14-17-9/h2-6H,7H2,1H3,(H2,13,15) |
| InChIKey | JXRSXAASRSLOEC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |