C12H10ClN3O — CID 106420447
5-[[2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 106420447) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-[[2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 106420447 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 5-[[2-(chloromethyl)benzimidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | ClCc1nc2ccccc2n1Cc1ccno1 |
| InChI | InChI=1S/C12H10ClN3O/c13-7-12-15-10-3-1-2-4-11(10)16(12)8-9-5-6-14-17-9/h1-6H,7-8H2 |
| InChIKey | KVXMDPABDMSGFF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|