C9H12N4O3 — CID 106421274
4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-2,6-dione (PubChem CID 106421274) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 106421274 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-2,6-dione |
| SMILES | Cc1noc(CCN2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C9H12N4O3/c1-6-10-9(16-12-6)2-3-13-4-7(14)11-8(15)5-13/h2-5H2,1H3,(H,11,14,15) |
| InChIKey | ZKHFYQRYGHRAMH-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|