C8H10N4O3 — CID 106422268
1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 106422268) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106422268 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1noc(CCN2CC(=O)NC2=O)n1 |
| InChI | InChI=1S/C8H10N4O3/c1-5-9-7(15-11-5)2-3-12-4-6(13)10-8(12)14/h2-4H2,1H3,(H,10,13,14) |
| InChIKey | FUGNXASMFAAKIH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|