C9H13NO3S — CID 106426638
(E)-4-oxo-4-(2-prop-2-enylsulfanylethylamino)but-2-enoic acid (PubChem CID 106426638) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (E)-4-oxo-4-(2-prop-2-enylsulfanylethylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(2-prop-2-enylsulfanylethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 106426638 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (E)-4-oxo-4-(2-prop-2-enylsulfanylethylamino)but-2-enoic acid |
| SMILES | C=CCSCCNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H13NO3S/c1-2-6-14-7-5-10-8(11)3-4-9(12)13/h2-4H,1,5-7H2,(H,10,11)(H,12,13)/b4-3+ |
| InChIKey | JDLUPCRZDSKAGK-ONEGZZNKSA-N |
| XLogP | 0.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|