C15H22F3NS — CID 106427012
3,3-dimethyl-1-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]butan-1-amine (PubChem CID 106427012) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-1-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 106427012 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3,3-dimethyl-1-phenyl-N-[2-(trifluoromethylsulfanyl)ethyl]butan-1-amine |
| SMILES | CC(C)(C)CC(NCCSC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H22F3NS/c1-14(2,3)11-13(12-7-5-4-6-8-12)19-9-10-20-15(16,17)18/h4-8,13,19H,9-11H2,1-3H3 |
| InChIKey | GKICZYMALZTTPV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|