C18H27N — CID 106209698
N-hex-5-ynyl-3,3-dimethyl-1-phenylbutan-1-amine (PubChem CID 106209698) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is N-hex-5-ynyl-3,3-dimethyl-1-phenylbutan-1-amine.
| Compound Name | N-hex-5-ynyl-3,3-dimethyl-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 106209698 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-hex-5-ynyl-3,3-dimethyl-1-phenylbutan-1-amine |
| SMILES | C#CCCCCNC(CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H27N/c1-5-6-7-11-14-19-17(15-18(2,3)4)16-12-9-8-10-13-16/h1,8-10,12-13,17,19H,6-7,11,14-15H2,2-4H3 |
| InChIKey | OENOWQYBYYKTND-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|