C12H18F3NS — CID 106427071
1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine (PubChem CID 106427071) has the molecular formula C12H18F3NS and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106427071 |
| Molecular Formula | C12H18F3NS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
| SMILES | CC(NCCSC(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C12H18F3NS/c1-8(16-4-5-17-12(13,14)15)11-7-9-2-3-10(11)6-9/h2-3,8-11,16H,4-7H2,1H3 |
| InChIKey | LJTJPWPIIBNHHW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|