C19H16N2O4S — CID 10642781
(2E,4E)-5-[1-(benzenesulfonyl)indol-2-yl]-N-hydroxypenta-2,4-dienamide (PubChem CID 10642781) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is (2E,4E)-5-[1-(benzenesulfonyl)indol-2-yl]-N-hydroxypenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-[1-(benzenesulfonyl)indol-2-yl]-N-hydroxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 10642781 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (2E,4E)-5-[1-(benzenesulfonyl)indol-2-yl]-N-hydroxypenta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1cc2ccccc2n1S(=O)(=O)c1ccccc1)NO |
| InChI | InChI=1S/C19H16N2O4S/c22-19(20-23)13-7-5-9-16-14-15-8-4-6-12-18(15)21(16)26(24,25)17-10-2-1-3-11-17/h1-14,23H,(H,20,22)/b9-5+,13-7+ |
| InChIKey | WLBCAZFQQOXASG-MHUSLGGSSA-N |
| XLogP | 2.95 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|