C8H13F3N2OS — CID 106428231
2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pent-4-enamide (PubChem CID 106428231) has the molecular formula C8H13F3N2OS and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pent-4-enamide.
| Compound Name | 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pent-4-enamide |
|---|---|
| PubChem CID | 106428231 |
| Molecular Formula | C8H13F3N2OS |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2OS/c1-2-3-6(12)7(14)13-4-5-15-8(9,10)11/h2,6H,1,3-5,12H2,(H,13,14) |
| InChIKey | SRXOIHOVXRWDID-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|