C9H15F3N2OS — CID 106429195
N-prop-2-enyl-2-[2-(trifluoromethylsulfanyl)ethylamino]propanamide (PubChem CID 106429195) has the molecular formula C9H15F3N2OS and a molecular weight of 256.29 g/mol. Its IUPAC name is N-prop-2-enyl-2-[2-(trifluoromethylsulfanyl)ethylamino]propanamide.
| Compound Name | N-prop-2-enyl-2-[2-(trifluoromethylsulfanyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 106429195 |
| Molecular Formula | C9H15F3N2OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-prop-2-enyl-2-[2-(trifluoromethylsulfanyl)ethylamino]propanamide |
| SMILES | C=CCNC(=O)C(C)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2OS/c1-3-4-14-8(15)7(2)13-5-6-16-9(10,11)12/h3,7,13H,1,4-6H2,2H3,(H,14,15) |
| InChIKey | TWBSHGDFUNSTJJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|